C13H26N4O3S — CID 145380694
acetamide;N-(1-amino-4-methyl-1-oxopentan-2-yl)-1-sulfanylpyrrolidine-2-carboxamide (PubChem CID 145380694) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is acetamide;N-(1-amino-4-methyl-1-oxopentan-2-yl)-1-sulfanylpyrrolidine-2-carboxamide.
| Compound Name | acetamide;N-(1-amino-4-methyl-1-oxopentan-2-yl)-1-sulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 145380694 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | acetamide;N-(1-amino-4-methyl-1-oxopentan-2-yl)-1-sulfanylpyrrolidine-2-carboxamide |
| SMILES | CC(C)CC(NC(=O)C1CCCN1S)C(N)=O.CC(N)=O |
| InChI | InChI=1S/C11H21N3O2S.C2H5NO/c1-7(2)6-8(10(12)15)13-11(16)9-4-3-5-14(9)17;1-2(3)4/h7-9,17H,3-6H2,1-2H3,(H2,12,15)(H,13,16);1H3,(H2,3,4) |
| InChIKey | CSKNYPPFVHAGKF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|