About barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide)
barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide) (PubChem CID 59137870) has the molecular formula C14H28BaN4+2
and a molecular weight of 389.73 g/mol. Its IUPAC name is barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide).
Molecular Properties
| Compound Name | barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide) |
| PubChem CID | 59137870 |
| Molecular Formula | C14H28BaN4+2 |
| Molecular Weight | 389.73 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide) |
| SMILES | C[N-]/C(C)=C\C(C)=[NH+]\C.C[N-]/C(C)=C\C(C)=[NH+]\C.[Ba+2] |
| InChI | InChI=1S/2C7H13N2.Ba/c2*1-6(8-3)5-7(2)9-4;/h2*5H,1-4H3;/q2*-1;+2/p+2/b2*6-5-,9-7+; |
| InChIKey | LUPLWBZCODZPEX-UVZXAKGHSA-P |
| XLogP | -0.25 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.73 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide)?
The IUPAC name of barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide) (CID 59137870) is barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide).
What is the SMILES notation for barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide)?
The canonical SMILES for barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide) is C[N-]/C(C)=C\C(C)=[NH+]\C.C[N-]/C(C)=C\C(C)=[NH+]\C.[Ba+2].
What is the InChIKey of barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide)?
The InChIKey is LUPLWBZCODZPEX-UVZXAKGHSA-P. The full InChI is InChI=1S/2C7H13N2.Ba/c2*1-6(8-3)5-7(2)9-4;/h2*5H,1-4H3;/q2*-1;+2/p+2/b2*6-5-,9-7+;.
What are the key properties of barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide)?
barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide) has a molecular weight of 389.73 g/mol, XLogP of -0.25, 4 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(methyl-[(Z)-4-methylazaniumylidenepent-2-en-2-yl]azanide) is sourced from PubChem (CID 59137870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).