C30H37N3O6 — CID 59138311
ethyl 2-[5-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-2-nitrophenoxy]-2-methylpropanoate (PubChem CID 59138311) has the molecular formula C30H37N3O6 and a molecular weight of 535.64 g/mol. Its IUPAC name is ethyl 2-[5-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-2-nitrophenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[5-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-2-nitrophenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 59138311 |
| Molecular Formula | C30H37N3O6 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | ethyl 2-[5-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]-2-nitrophenoxy]-2-methylpropanoate |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccc([N+](=O)[O-])c(OC(C)(C)C(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C30H37N3O6/c1-5-7-10-26-31-30(17-8-9-18-30)27(34)32(26)20-21-11-13-22(14-12-21)23-15-16-24(33(36)37)25(19-23)39-29(3,4)28(35)38-6-2/h11-16,19H,5-10,17-18,20H2,1-4H3 |
| InChIKey | IYKOPCQCADJWIX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|