C24H33N3O6 — CID 59141364
ethyl (E)-2-[(E)-2-[4-[[2-(6-acetamidohexanoylamino)acetyl]amino]phenyl]ethenyl]-4-hydroxybut-2-enoate (PubChem CID 59141364) has the molecular formula C24H33N3O6 and a molecular weight of 459.54 g/mol. Its IUPAC name is ethyl (E)-2-[(E)-2-[4-[[2-(6-acetamidohexanoylamino)acetyl]amino]phenyl]ethenyl]-4-hydroxybut-2-enoate.
| Compound Name | ethyl (E)-2-[(E)-2-[4-[[2-(6-acetamidohexanoylamino)acetyl]amino]phenyl]ethenyl]-4-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 59141364 |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | ethyl (E)-2-[(E)-2-[4-[[2-(6-acetamidohexanoylamino)acetyl]amino]phenyl]ethenyl]-4-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccc(NC(=O)CNC(=O)CCCCCNC(C)=O)cc1)=C/CO |
| InChI | InChI=1S/C24H33N3O6/c1-3-33-24(32)20(14-16-28)11-8-19-9-12-21(13-10-19)27-23(31)17-26-22(30)7-5-4-6-15-25-18(2)29/h8-14,28H,3-7,15-17H2,1-2H3,(H,25,29)(H,26,30)(H,27,31)/b11-8+,20-14+ |
| InChIKey | GOARJEOLEFRABE-BTXLNPSKSA-N |
| XLogP | 1.93 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|