C26H29N5O7 — CID 72527251
ethyl 4-hydroxy-2-[2-[4-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoylamino]phenyl]ethenyl]but-2-enoate (PubChem CID 72527251) has the molecular formula C26H29N5O7 and a molecular weight of 523.55 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-[2-[4-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoylamino]phenyl]ethenyl]but-2-enoate.
| Compound Name | ethyl 4-hydroxy-2-[2-[4-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoylamino]phenyl]ethenyl]but-2-enoate |
|---|---|
| PubChem CID | 72527251 |
| Molecular Formula | C26H29N5O7 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | ethyl 4-hydroxy-2-[2-[4-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoylamino]phenyl]ethenyl]but-2-enoate |
| SMILES | CCOC(=O)C(C=Cc1ccc(NC(=O)CCCCCNc2ccc([N+](=O)[O-])c3nonc23)cc1)=CCO |
| InChI | InChI=1S/C26H29N5O7/c1-2-37-26(34)19(15-17-32)10-7-18-8-11-20(12-9-18)28-23(33)6-4-3-5-16-27-21-13-14-22(31(35)36)25-24(21)29-38-30-25/h7-15,27,32H,2-6,16-17H2,1H3,(H,28,33) |
| InChIKey | VXIYMWICUSWMQQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|