C27H41O — CID 59142169
CID 59142169 (PubChem CID 59142169) has the molecular formula C27H41O and a molecular weight of 381.62 g/mol.
| Compound Name | CID 59142169 |
|---|---|
| PubChem CID | 59142169 |
| Molecular Formula | C27H41O |
| Molecular Weight | 381.62 g/mol |
| Exact Mass | 381.32 |
| IUPAC Name | — |
| SMILES | C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@]2([C@H](C)/C=C/[C@H](C)C(C)C)[CH]CC[C@@H]12 |
| InChI | InChI=1S/C27H41O/c1-19(2)20(3)10-12-22(5)27-16-6-8-23(26(27)9-7-17-27)13-14-24-18-25(28)15-11-21(24)4/h10,12-14,17,19-20,22,25-26,28H,4,6-9,11,15-16,18H2,1-3,5H3/b12-10+,23-13+,24-14-/t20-,22+,25-,26-,27+/m0/s1 |
| InChIKey | RAZJDGQSLQUHEF-PZZQFOOASA-N |
| XLogP | 7.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|