C25H37NO4 — CID 59142289
4-[1-deuterio-2-[6-(1,1-dideuterio-4-phenylbutoxy)hexylamino]-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol (PubChem CID 59142289) has the molecular formula C25H37NO4 and a molecular weight of 420.60 g/mol. Its IUPAC name is 4-[1-deuterio-2-[6-(1,1-dideuterio-4-phenylbutoxy)hexylamino]-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol.
| Compound Name | 4-[1-deuterio-2-[6-(1,1-dideuterio-4-phenylbutoxy)hexylamino]-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol |
|---|---|
| PubChem CID | 59142289 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | 4-[1-deuterio-2-[6-(1,1-dideuterio-4-phenylbutoxy)hexylamino]-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol |
| SMILES | [2H]C([2H])(CCCc1ccccc1)OCCCCCCNCC([2H])(O)c1ccc(O)c(C([2H])([2H])O)c1 |
| InChI | InChI=1S/C25H37NO4/c27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21/h3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2/i17D2,20D2,25D |
| InChIKey | GIIZNNXWQWCKIB-LSADUZDDSA-N |
| XLogP | 4.11 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|