C15H28O2 — CID 59143559
2,2,7,7-tetramethyl-5-prop-2-enoxyoctan-4-one (PubChem CID 59143559) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2,2,7,7-tetramethyl-5-prop-2-enoxyoctan-4-one.
| Compound Name | 2,2,7,7-tetramethyl-5-prop-2-enoxyoctan-4-one |
|---|---|
| PubChem CID | 59143559 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2,2,7,7-tetramethyl-5-prop-2-enoxyoctan-4-one |
| SMILES | C=CCOC(CC(C)(C)C)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C15H28O2/c1-8-9-17-13(11-15(5,6)7)12(16)10-14(2,3)4/h8,13H,1,9-11H2,2-7H3 |
| InChIKey | WHFAMMQCTJYXPV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|