C16H28O — CID 59143638
5-(cyclopentylmethyl)-2,2-dimethyloct-7-en-4-one (PubChem CID 59143638) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 5-(cyclopentylmethyl)-2,2-dimethyloct-7-en-4-one.
| Compound Name | 5-(cyclopentylmethyl)-2,2-dimethyloct-7-en-4-one |
|---|---|
| PubChem CID | 59143638 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 5-(cyclopentylmethyl)-2,2-dimethyloct-7-en-4-one |
| SMILES | C=CCC(CC1CCCC1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H28O/c1-5-8-14(11-13-9-6-7-10-13)15(17)12-16(2,3)4/h5,13-14H,1,6-12H2,2-4H3 |
| InChIKey | HHMOKYMRBAKZMS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|