C18H32O — CID 59143680
1-cyclopentyl-6-methyl-3-[(2-methylcyclopropyl)methyl]heptan-4-one (PubChem CID 59143680) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is 1-cyclopentyl-6-methyl-3-[(2-methylcyclopropyl)methyl]heptan-4-one.
| Compound Name | 1-cyclopentyl-6-methyl-3-[(2-methylcyclopropyl)methyl]heptan-4-one |
|---|---|
| PubChem CID | 59143680 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 1-cyclopentyl-6-methyl-3-[(2-methylcyclopropyl)methyl]heptan-4-one |
| SMILES | CC(C)CC(=O)C(CCC1CCCC1)CC1CC1C |
| InChI | InChI=1S/C18H32O/c1-13(2)10-18(19)16(12-17-11-14(17)3)9-8-15-6-4-5-7-15/h13-17H,4-12H2,1-3H3 |
| InChIKey | ULLMQRWLJRFOIF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |