C16H23FN6 — CID 59144861
5-fluoro-2-[4-[4-(4-methylpyrazol-1-yl)butyl]piperazin-1-yl]pyrimidine (PubChem CID 59144861) has the molecular formula C16H23FN6 and a molecular weight of 318.40 g/mol. Its IUPAC name is 5-fluoro-2-[4-[4-(4-methylpyrazol-1-yl)butyl]piperazin-1-yl]pyrimidine.
| Compound Name | 5-fluoro-2-[4-[4-(4-methylpyrazol-1-yl)butyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 59144861 |
| Molecular Formula | C16H23FN6 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 5-fluoro-2-[4-[4-(4-methylpyrazol-1-yl)butyl]piperazin-1-yl]pyrimidine |
| SMILES | Cc1cnn(CCCCN2CCN(c3ncc(F)cn3)CC2)c1 |
| InChI | InChI=1S/C16H23FN6/c1-14-10-20-23(13-14)5-3-2-4-21-6-8-22(9-7-21)16-18-11-15(17)12-19-16/h10-13H,2-9H2,1H3 |
| InChIKey | MXFVLJBANGCQDE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|