C43H27F2N3O3 — CID 59147408
9-[3-[5-(5-carbazol-9-yl-2-methoxyphenyl)-2,4-difluorophenyl]-4-nitrophenyl]carbazole (PubChem CID 59147408) has the molecular formula C43H27F2N3O3 and a molecular weight of 671.70 g/mol. Its IUPAC name is 9-[3-[5-(5-carbazol-9-yl-2-methoxyphenyl)-2,4-difluorophenyl]-4-nitrophenyl]carbazole.
| Compound Name | 9-[3-[5-(5-carbazol-9-yl-2-methoxyphenyl)-2,4-difluorophenyl]-4-nitrophenyl]carbazole |
|---|---|
| PubChem CID | 59147408 |
| Molecular Formula | C43H27F2N3O3 |
| Molecular Weight | 671.70 g/mol |
| Exact Mass | 671.20 |
| IUPAC Name | 9-[3-[5-(5-carbazol-9-yl-2-methoxyphenyl)-2,4-difluorophenyl]-4-nitrophenyl]carbazole |
| SMILES | COc1ccc(-n2c3ccccc3c3ccccc32)cc1-c1cc(-c2cc(-n3c4ccccc4c4ccccc43)ccc2[N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C43H27F2N3O3/c1-51-43-21-19-27(47-40-16-8-4-12-30(40)31-13-5-9-17-41(31)47)23-35(43)33-24-32(36(44)25-37(33)45)34-22-26(18-20-42(34)48(49)50)46-38-14-6-2-10-28(38)29-11-3-7-15-39(29)46/h2-25H,1H3 |
| InChIKey | VYJCOEMZDAXUDV-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 62.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.70 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|