C24H19F3N2O4S2 — CID 59147925
4-methyl-N-(3-methyl-1-benzothiophen-2-yl)-N-[[4-nitro-3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 59147925) has the molecular formula C24H19F3N2O4S2 and a molecular weight of 520.55 g/mol. Its IUPAC name is 4-methyl-N-(3-methyl-1-benzothiophen-2-yl)-N-[[4-nitro-3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-(3-methyl-1-benzothiophen-2-yl)-N-[[4-nitro-3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59147925 |
| Molecular Formula | C24H19F3N2O4S2 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 4-methyl-N-(3-methyl-1-benzothiophen-2-yl)-N-[[4-nitro-3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)c2sc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C24H19F3N2O4S2/c1-15-7-10-18(11-8-15)35(32,33)28(23-16(2)19-5-3-4-6-22(19)34-23)14-17-9-12-21(29(30)31)20(13-17)24(25,26)27/h3-13H,14H2,1-2H3 |
| InChIKey | OGVOVBODEOEDTQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|