C33H35N3O8 — CID 59148271
[(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoate (PubChem CID 59148271) has the molecular formula C33H35N3O8 and a molecular weight of 601.66 g/mol. Its IUPAC name is [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoate.
| Compound Name | [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoate |
|---|---|
| PubChem CID | 59148271 |
| Molecular Formula | C33H35N3O8 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)CCCCCN4C(=O)CC(C)C4=O)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
| InChI | InChI=1S/C33H35N3O8/c1-4-20-21-14-19(44-28(38)9-7-6-8-12-35-27(37)13-18(3)30(35)39)10-11-25(21)34-29-22(20)16-36-26(29)15-24-23(31(36)40)17-43-32(41)33(24,42)5-2/h10-11,14-15,18,42H,4-9,12-13,16-17H2,1-3H3/t18?,33-/m0/s1 |
| InChIKey | YDSMVIZPUPLIMC-LUWDARPISA-N |
| XLogP | 3.50 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|