C16H13NaO6S2 — CID 59148553
sodium 2-hydroxy-3-(9-oxothioxanthen-2-yl)oxypropane-1-sulfonate (PubChem CID 59148553) has the molecular formula C16H13NaO6S2 and a molecular weight of 388.40 g/mol. Its IUPAC name is sodium 2-hydroxy-3-(9-oxothioxanthen-2-yl)oxypropane-1-sulfonate.
| Compound Name | sodium 2-hydroxy-3-(9-oxothioxanthen-2-yl)oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 59148553 |
| Molecular Formula | C16H13NaO6S2 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | sodium 2-hydroxy-3-(9-oxothioxanthen-2-yl)oxypropane-1-sulfonate |
| SMILES | O=c1c2ccccc2sc2ccc(OCC(O)CS(=O)(=O)[O-])cc12.[Na+] |
| InChI | InChI=1S/C16H14O6S2.Na/c17-10(9-24(19,20)21)8-22-11-5-6-15-13(7-11)16(18)12-3-1-2-4-14(12)23-15;/h1-7,10,17H,8-9H2,(H,19,20,21);/q;+1/p-1 |
| InChIKey | XJEFRSXCLUJQIZ-UHFFFAOYSA-M |
| XLogP | -1.30 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|