C38H35F3O4 — CID 59150731
ethyl (1S,4R)-4-[6-oxo-6-[2-[4-(trifluoromethyl)phenyl]phenyl]hexanoyl]-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate (PubChem CID 59150731) has the molecular formula C38H35F3O4 and a molecular weight of 612.69 g/mol. Its IUPAC name is ethyl (1S,4R)-4-[6-oxo-6-[2-[4-(trifluoromethyl)phenyl]phenyl]hexanoyl]-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1S,4R)-4-[6-oxo-6-[2-[4-(trifluoromethyl)phenyl]phenyl]hexanoyl]-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 59150731 |
| Molecular Formula | C38H35F3O4 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | ethyl (1S,4R)-4-[6-oxo-6-[2-[4-(trifluoromethyl)phenyl]phenyl]hexanoyl]-1-phenyl-3,4-dihydro-2H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccccc2)CC[C@@H](C(=O)CCCCC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c2ccccc21 |
| InChI | InChI=1S/C38H35F3O4/c1-2-45-36(44)37(27-12-4-3-5-13-27)25-24-32(30-15-8-9-17-33(30)37)35(43)19-11-10-18-34(42)31-16-7-6-14-29(31)26-20-22-28(23-21-26)38(39,40)41/h3-9,12-17,20-23,32H,2,10-11,18-19,24-25H2,1H3/t32-,37+/m1/s1 |
| InChIKey | LZRZCZQIXQOQLP-JJQXXVEZSA-N |
| XLogP | 9.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|