C15H21NO2 — CID 59153788
2-(5-methylhexyl)-3a,7a-dihydroisoindole-1,3-dione (PubChem CID 59153788) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(5-methylhexyl)-3a,7a-dihydroisoindole-1,3-dione.
| Compound Name | 2-(5-methylhexyl)-3a,7a-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 59153788 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-(5-methylhexyl)-3a,7a-dihydroisoindole-1,3-dione |
| SMILES | CC(C)CCCCN1C(=O)C2C=CC=CC2C1=O |
| InChI | InChI=1S/C15H21NO2/c1-11(2)7-5-6-10-16-14(17)12-8-3-4-9-13(12)15(16)18/h3-4,8-9,11-13H,5-7,10H2,1-2H3 |
| InChIKey | QISOTTRAFQBDGD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|