C19H20F2N2O3 — CID 59156538
2,6-difluoro-N-[5-[3-(oxan-4-yl)propanoyl]-2H-pyrrol-4-yl]benzamide (PubChem CID 59156538) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2,6-difluoro-N-[5-[3-(oxan-4-yl)propanoyl]-2H-pyrrol-4-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[5-[3-(oxan-4-yl)propanoyl]-2H-pyrrol-4-yl]benzamide |
|---|---|
| PubChem CID | 59156538 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2,6-difluoro-N-[5-[3-(oxan-4-yl)propanoyl]-2H-pyrrol-4-yl]benzamide |
| SMILES | O=C(CCC1CCOCC1)C1=NCC=C1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C19H20F2N2O3/c20-13-2-1-3-14(21)17(13)19(25)23-15-6-9-22-18(15)16(24)5-4-12-7-10-26-11-8-12/h1-3,6,12H,4-5,7-11H2,(H,23,25) |
| InChIKey | SOIBFGBDOKWSQV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |