C8H12O2S2 — CID 59157299
1,4-dithian-2-yl 2-methylprop-2-enoate (PubChem CID 59157299) has the molecular formula C8H12O2S2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1,4-dithian-2-yl 2-methylprop-2-enoate.
| Compound Name | 1,4-dithian-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59157299 |
| Molecular Formula | C8H12O2S2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 1,4-dithian-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CSCCS1 |
| InChI | InChI=1S/C8H12O2S2/c1-6(2)8(9)10-7-5-11-3-4-12-7/h7H,1,3-5H2,2H3 |
| InChIKey | JHHOFYKCAOIWOR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|