C37H45FN2O6Si — CID 59158273
ethyl 6-[(4-fluorophenyl)methyl]-12-oxo-10-phenylmethoxy-3-[tri(propan-2-yl)silyloxymethyl]-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate (PubChem CID 59158273) has the molecular formula C37H45FN2O6Si and a molecular weight of 660.86 g/mol. Its IUPAC name is ethyl 6-[(4-fluorophenyl)methyl]-12-oxo-10-phenylmethoxy-3-[tri(propan-2-yl)silyloxymethyl]-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate.
| Compound Name | ethyl 6-[(4-fluorophenyl)methyl]-12-oxo-10-phenylmethoxy-3-[tri(propan-2-yl)silyloxymethyl]-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 59158273 |
| Molecular Formula | C37H45FN2O6Si |
| Molecular Weight | 660.86 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | ethyl 6-[(4-fluorophenyl)methyl]-12-oxo-10-phenylmethoxy-3-[tri(propan-2-yl)silyloxymethyl]-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate |
| SMILES | CCOC(=O)c1c(OCc2ccccc2)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)CC(CO[Si](C(C)C)(C(C)C)C(C)C)O3 |
| InChI | InChI=1S/C37H45FN2O6Si/c1-8-43-37(42)31-35(44-21-27-12-10-9-11-13-27)32-33-34(28(19-39-32)18-26-14-16-29(38)17-15-26)46-30(20-40(33)36(31)41)22-45-47(23(2)3,24(4)5)25(6)7/h9-17,19,23-25,30H,8,18,20-22H2,1-7H3 |
| InChIKey | XTWJATHVSLTCNK-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.86 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|