C20H22N2O3S — CID 59158792
4-[3-[(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl)oxy]propyl]benzonitrile (PubChem CID 59158792) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-[3-[(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl)oxy]propyl]benzonitrile.
| Compound Name | 4-[3-[(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl)oxy]propyl]benzonitrile |
|---|---|
| PubChem CID | 59158792 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-[3-[(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl)oxy]propyl]benzonitrile |
| SMILES | CS(=O)(=O)N1CCc2cc(OCCCc3ccc(C#N)cc3)ccc2C1 |
| InChI | InChI=1S/C20H22N2O3S/c1-26(23,24)22-11-10-18-13-20(9-8-19(18)15-22)25-12-2-3-16-4-6-17(14-21)7-5-16/h4-9,13H,2-3,10-12,15H2,1H3 |
| InChIKey | VIMNBPJJBIRPIL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|