C25H24ClNO5 — CID 59159850
3'-[5-chloro-2-methyl-4-(3-nitrophenyl)phenyl]-4'-hydroxyspiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-furan]-2'-one (PubChem CID 59159850) has the molecular formula C25H24ClNO5 and a molecular weight of 453.92 g/mol. Its IUPAC name is 3'-[5-chloro-2-methyl-4-(3-nitrophenyl)phenyl]-4'-hydroxyspiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-furan]-2'-one.
| Compound Name | 3'-[5-chloro-2-methyl-4-(3-nitrophenyl)phenyl]-4'-hydroxyspiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-furan]-2'-one |
|---|---|
| PubChem CID | 59159850 |
| Molecular Formula | C25H24ClNO5 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 3'-[5-chloro-2-methyl-4-(3-nitrophenyl)phenyl]-4'-hydroxyspiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-furan]-2'-one |
| SMILES | Cc1cc(-c2cccc([N+](=O)[O-])c2)c(Cl)cc1C1=C(O)C2(CCC3CCCC3C2)OC1=O |
| InChI | InChI=1S/C25H24ClNO5/c1-14-10-20(16-5-3-7-18(11-16)27(30)31)21(26)12-19(14)22-23(28)25(32-24(22)29)9-8-15-4-2-6-17(15)13-25/h3,5,7,10-12,15,17,28H,2,4,6,8-9,13H2,1H3 |
| InChIKey | DYQFCOBKBWRVRZ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|