C30H28FN3O3S — CID 59160926
4-[4-(5-acetyl-4-methyl-1,3-thiazol-2-yl)oxan-4-yl]-N-[2-amino-5-(4-fluorophenyl)phenyl]benzamide (PubChem CID 59160926) has the molecular formula C30H28FN3O3S and a molecular weight of 529.64 g/mol. Its IUPAC name is 4-[4-(5-acetyl-4-methyl-1,3-thiazol-2-yl)oxan-4-yl]-N-[2-amino-5-(4-fluorophenyl)phenyl]benzamide.
| Compound Name | 4-[4-(5-acetyl-4-methyl-1,3-thiazol-2-yl)oxan-4-yl]-N-[2-amino-5-(4-fluorophenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 59160926 |
| Molecular Formula | C30H28FN3O3S |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 4-[4-(5-acetyl-4-methyl-1,3-thiazol-2-yl)oxan-4-yl]-N-[2-amino-5-(4-fluorophenyl)phenyl]benzamide |
| SMILES | CC(=O)c1sc(C2(c3ccc(C(=O)Nc4cc(-c5ccc(F)cc5)ccc4N)cc3)CCOCC2)nc1C |
| InChI | InChI=1S/C30H28FN3O3S/c1-18-27(19(2)35)38-29(33-18)30(13-15-37-16-14-30)23-8-3-21(4-9-23)28(36)34-26-17-22(7-12-25(26)32)20-5-10-24(31)11-6-20/h3-12,17H,13-16,32H2,1-2H3,(H,34,36) |
| InChIKey | AEHQOJSUODQORK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|