C17H16ClNO4 — CID 59164741
[4-(4-chlorophenyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] acetate (PubChem CID 59164741) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] acetate.
| Compound Name | [4-(4-chlorophenyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] acetate |
|---|---|
| PubChem CID | 59164741 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [4-(4-chlorophenyl)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] acetate |
| SMILES | CC(=O)OC1CC2CC1C1C(=O)N(c3ccc(Cl)cc3)C(=O)C21 |
| InChI | InChI=1S/C17H16ClNO4/c1-8(20)23-13-7-9-6-12(13)15-14(9)16(21)19(17(15)22)11-4-2-10(18)3-5-11/h2-5,9,12-15H,6-7H2,1H3 |
| InChIKey | CNAPOBFWRAKCGM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|