C23H20BrNO3 — CID 98409224
(1R,2R,6R,7R,8R)-8-(4-acetylphenyl)-4-(4-bromophenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98409224) has the molecular formula C23H20BrNO3 and a molecular weight of 438.32 g/mol. Its IUPAC name is (1R,2R,6R,7R,8R)-8-(4-acetylphenyl)-4-(4-bromophenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6R,7R,8R)-8-(4-acetylphenyl)-4-(4-bromophenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98409224 |
| Molecular Formula | C23H20BrNO3 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | (1R,2R,6R,7R,8R)-8-(4-acetylphenyl)-4-(4-bromophenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC(=O)c1ccc([C@@H]2C[C@H]3C[C@H]2[C@H]2C(=O)N(c4ccc(Br)cc4)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C23H20BrNO3/c1-12(26)13-2-4-14(5-3-13)18-10-15-11-19(18)21-20(15)22(27)25(23(21)28)17-8-6-16(24)7-9-17/h2-9,15,18-21H,10-11H2,1H3/t15-,18-,19+,20+,21+/m0/s1 |
| InChIKey | TYYDBWHWRWDCEA-NWRWZVFGSA-N |
| XLogP | 4.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|