C23H22BrNO2 — CID 98337018
(1R,2S,6R,7R,8R)-4-(4-bromophenyl)-8-(2,5-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98337018) has the molecular formula C23H22BrNO2 and a molecular weight of 424.34 g/mol. Its IUPAC name is (1R,2S,6R,7R,8R)-4-(4-bromophenyl)-8-(2,5-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7R,8R)-4-(4-bromophenyl)-8-(2,5-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98337018 |
| Molecular Formula | C23H22BrNO2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | (1R,2S,6R,7R,8R)-4-(4-bromophenyl)-8-(2,5-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1ccc(C)c([C@@H]2C[C@H]3C[C@H]2[C@H]2C(=O)N(c4ccc(Br)cc4)C(=O)[C@@H]32)c1 |
| InChI | InChI=1S/C23H22BrNO2/c1-12-3-4-13(2)17(9-12)18-10-14-11-19(18)21-20(14)22(26)25(23(21)27)16-7-5-15(24)6-8-16/h3-9,14,18-21H,10-11H2,1-2H3/t14-,18-,19+,20-,21+/m0/s1 |
| InChIKey | DVHJAOIKKDPRIM-YRJNGXSBSA-N |
| XLogP | 5.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|