C25H18N2O4 — CID 59164813
(2S,6R)-4-(4-nitronaphthalen-1-yl)-8-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 59164813) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is (2S,6R)-4-(4-nitronaphthalen-1-yl)-8-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (2S,6R)-4-(4-nitronaphthalen-1-yl)-8-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 59164813 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (2S,6R)-4-(4-nitronaphthalen-1-yl)-8-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2C3CC(C=C3c3ccccc3)[C@@H]2C(=O)N1c1ccc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C25H18N2O4/c28-24-22-15-12-18(14-6-2-1-3-7-14)19(13-15)23(22)25(29)26(24)20-10-11-21(27(30)31)17-9-5-4-8-16(17)20/h1-12,15,19,22-23H,13H2/t15?,19?,22-,23+/m0/s1 |
| InChIKey | PVJPLNFNFQSHFB-WBOGZLIBSA-N |
| XLogP | 4.59 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|