C21H18N2O4 — CID 68547802
(1S,2R,6S,7R)-2-methyl-4-(4-nitronaphthalen-1-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 68547802) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is (1S,2R,6S,7R)-2-methyl-4-(4-nitronaphthalen-1-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-2-methyl-4-(4-nitronaphthalen-1-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 68547802 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (1S,2R,6S,7R)-2-methyl-4-(4-nitronaphthalen-1-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | C[C@]12C(=O)N(c3ccc([N+](=O)[O-])c4ccccc34)C(=O)[C@H]1[C@H]1C=C[C@@H]2CC1 |
| InChI | InChI=1S/C21H18N2O4/c1-21-13-8-6-12(7-9-13)18(21)19(24)22(20(21)25)16-10-11-17(23(26)27)15-5-3-2-4-14(15)16/h2-6,8,10-13,18H,7,9H2,1H3/t12-,13+,18+,21+/m0/s1 |
| InChIKey | YFKYGSJTZPFKFJ-PYTOLBBTSA-N |
| XLogP | 3.84 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|