C20H27ClN2O6 — CID 59165785
1-O-tert-butyl 4-O-ethyl 4-[(5-chloro-2-nitrophenyl)methyl]piperidine-1,4-dicarboxylate (PubChem CID 59165785) has the molecular formula C20H27ClN2O6 and a molecular weight of 426.90 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 4-[(5-chloro-2-nitrophenyl)methyl]piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl 4-[(5-chloro-2-nitrophenyl)methyl]piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 59165785 |
| Molecular Formula | C20H27ClN2O6 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 4-[(5-chloro-2-nitrophenyl)methyl]piperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1(Cc2cc(Cl)ccc2[N+](=O)[O-])CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H27ClN2O6/c1-5-28-17(24)20(13-14-12-15(21)6-7-16(14)23(26)27)8-10-22(11-9-20)18(25)29-19(2,3)4/h6-7,12H,5,8-11,13H2,1-4H3 |
| InChIKey | FZJCCIZMBAUQQH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|