C18H16O4S2 — CID 59167362
(2-acetyloxy-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl) acetate (PubChem CID 59167362) has the molecular formula C18H16O4S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (2-acetyloxy-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl) acetate.
| Compound Name | (2-acetyloxy-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl) acetate |
|---|---|
| PubChem CID | 59167362 |
| Molecular Formula | C18H16O4S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (2-acetyloxy-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl) acetate |
| SMILES | CC(=O)Oc1cc2c(cc1C)SSc1cc(C)c(OC(C)=O)cc1-2 |
| InChI | InChI=1S/C18H16O4S2/c1-9-5-17-13(7-15(9)21-11(3)19)14-8-16(22-12(4)20)10(2)6-18(14)24-23-17/h5-8H,1-4H3 |
| InChIKey | YYUGPSHICFJGHQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|