C26H34O4S — CID 91743809
[4-(4-acetyloxy-5-tert-butyl-2-methylphenyl)sulfanyl-2-tert-butyl-5-methylphenyl] acetate (PubChem CID 91743809) has the molecular formula C26H34O4S and a molecular weight of 442.62 g/mol. Its IUPAC name is [4-(4-acetyloxy-5-tert-butyl-2-methylphenyl)sulfanyl-2-tert-butyl-5-methylphenyl] acetate.
| Compound Name | [4-(4-acetyloxy-5-tert-butyl-2-methylphenyl)sulfanyl-2-tert-butyl-5-methylphenyl] acetate |
|---|---|
| PubChem CID | 91743809 |
| Molecular Formula | C26H34O4S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [4-(4-acetyloxy-5-tert-butyl-2-methylphenyl)sulfanyl-2-tert-butyl-5-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cc(C)c(Sc2cc(C(C)(C)C)c(OC(C)=O)cc2C)cc1C(C)(C)C |
| InChI | InChI=1S/C26H34O4S/c1-15-11-21(29-17(3)27)19(25(5,6)7)13-23(15)31-24-14-20(26(8,9)10)22(12-16(24)2)30-18(4)28/h11-14H,1-10H3 |
| InChIKey | HJVRTJOXJRZISJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|