C17H19ClN2O2 — CID 59170259
5-(2-chlorophenyl)-N-(cyclohexylmethyl)-1,2-oxazole-4-carboxamide (PubChem CID 59170259) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-(cyclohexylmethyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-(cyclohexylmethyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 59170259 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-(2-chlorophenyl)-N-(cyclohexylmethyl)-1,2-oxazole-4-carboxamide |
| SMILES | O=C(NCC1CCCCC1)c1cnoc1-c1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN2O2/c18-15-9-5-4-8-13(15)16-14(11-20-22-16)17(21)19-10-12-6-2-1-3-7-12/h4-5,8-9,11-12H,1-3,6-7,10H2,(H,19,21) |
| InChIKey | SNHKSCWJMBWHGF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |