C18H22Cl2N4O — CID 59173824
N-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-4-piperidin-1-ylbutanamide (PubChem CID 59173824) has the molecular formula C18H22Cl2N4O and a molecular weight of 381.31 g/mol. Its IUPAC name is N-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-4-piperidin-1-ylbutanamide.
| Compound Name | N-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-4-piperidin-1-ylbutanamide |
|---|---|
| PubChem CID | 59173824 |
| Molecular Formula | C18H22Cl2N4O |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-4-piperidin-1-ylbutanamide |
| SMILES | O=C(CCCN1CCCCC1)Nc1cc(-c2ccc(Cl)cc2Cl)[nH]n1 |
| InChI | InChI=1S/C18H22Cl2N4O/c19-13-6-7-14(15(20)11-13)16-12-17(23-22-16)21-18(25)5-4-10-24-8-2-1-3-9-24/h6-7,11-12H,1-5,8-10H2,(H2,21,22,23,25) |
| InChIKey | IUJYJTJDPDEQJR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |