C17H20Cl2N4O — CID 59173834
N-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-4-pyrrolidin-1-ylbutanamide (PubChem CID 59173834) has the molecular formula C17H20Cl2N4O and a molecular weight of 367.28 g/mol. Its IUPAC name is N-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-4-pyrrolidin-1-ylbutanamide.
| Compound Name | N-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-4-pyrrolidin-1-ylbutanamide |
|---|---|
| PubChem CID | 59173834 |
| Molecular Formula | C17H20Cl2N4O |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-4-pyrrolidin-1-ylbutanamide |
| SMILES | O=C(CCCN1CCCC1)Nc1cc(-c2ccc(Cl)cc2Cl)[nH]n1 |
| InChI | InChI=1S/C17H20Cl2N4O/c18-12-5-6-13(14(19)10-12)15-11-16(22-21-15)20-17(24)4-3-9-23-7-1-2-8-23/h5-6,10-11H,1-4,7-9H2,(H2,20,21,22,24) |
| InChIKey | IYGZILQPOQAHIF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |