C29H29F7N6O3 — CID 59175894
1-(3-cyclopropyl-1-methylpyrazol-5-yl)-3-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]urea (PubChem CID 59175894) has the molecular formula C29H29F7N6O3 and a molecular weight of 642.58 g/mol. Its IUPAC name is 1-(3-cyclopropyl-1-methylpyrazol-5-yl)-3-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]urea.
| Compound Name | 1-(3-cyclopropyl-1-methylpyrazol-5-yl)-3-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 59175894 |
| Molecular Formula | C29H29F7N6O3 |
| Molecular Weight | 642.58 g/mol |
| Exact Mass | 642.22 |
| IUPAC Name | 1-(3-cyclopropyl-1-methylpyrazol-5-yl)-3-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]urea |
| SMILES | Cn1nc(C2CC2)cc1NC(=O)Nc1ccc(C(=O)N2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1F |
| InChI | InChI=1S/C29H29F7N6O3/c1-40-24(15-23(39-40)18-4-5-18)38-26(44)37-22-9-6-19(14-21(22)30)25(43)42-12-10-41(11-13-42)16-17-2-7-20(8-3-17)27(45,28(31,32)33)29(34,35)36/h2-3,6-9,14-15,18,45H,4-5,10-13,16H2,1H3,(H2,37,38,44) |
| InChIKey | HLSNYELDSYPMAJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |