About 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium
9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium (PubChem CID 59176535) has the molecular formula C13H11N2Y-
and a molecular weight of 284.15 g/mol. Its IUPAC name is 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium.
Molecular Properties
| Compound Name | 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium |
| PubChem CID | 59176535 |
| Molecular Formula | C13H11N2Y- |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium |
| SMILES | [CH2-]n1c2ccc(C)cc2c2ccncc21.[Y] |
| InChI | InChI=1S/C13H11N2.Y/c1-9-3-4-12-11(7-9)10-5-6-14-8-13(10)15(12)2;/h3-8H,2H2,1H3;/q-1; |
| InChIKey | KJSMLNDCCYFGDD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium?
The IUPAC name of 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium (CID 59176535) is 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium.
What is the SMILES notation for 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium?
The canonical SMILES for 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium is [CH2-]n1c2ccc(C)cc2c2ccncc21.[Y].
What is the InChIKey of 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium?
The InChIKey is KJSMLNDCCYFGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N2.Y/c1-9-3-4-12-11(7-9)10-5-6-14-8-13(10)15(12)2;/h3-8H,2H2,1H3;/q-1;.
What are the key properties of 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium?
9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium has a molecular weight of 284.15 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methanidyl-6-methylpyrido[3,4-b]indole;yttrium is sourced from PubChem (CID 59176535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).