C30H30ClN3O2 — CID 59178568
6-chloro-4-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-3-phenylpiperidin-1-yl]pyridine-3-carboxylic acid (PubChem CID 59178568) has the molecular formula C30H30ClN3O2 and a molecular weight of 500.04 g/mol. Its IUPAC name is 6-chloro-4-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-3-phenylpiperidin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-4-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-3-phenylpiperidin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 59178568 |
| Molecular Formula | C30H30ClN3O2 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 6-chloro-4-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-3-phenylpiperidin-1-yl]pyridine-3-carboxylic acid |
| SMILES | C[C@@H](NCC1CCN(c2cc(Cl)ncc2C(=O)O)CC1c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H30ClN3O2/c1-20(24-13-7-11-21-10-5-6-12-25(21)24)32-17-23-14-15-34(19-27(23)22-8-3-2-4-9-22)28-16-29(31)33-18-26(28)30(35)36/h2-13,16,18,20,23,27,32H,14-15,17,19H2,1H3,(H,35,36)/t20-,23?,27?/m1/s1 |
| InChIKey | XWMSZGQJXHWPCT-ZDCWCPCNSA-N |
| XLogP | 6.55 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|