C34H34N2O3 — CID 59178751
4-[(E)-3-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-3-phenylpiperidin-1-yl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 59178751) has the molecular formula C34H34N2O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is 4-[(E)-3-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-3-phenylpiperidin-1-yl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-3-phenylpiperidin-1-yl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 59178751 |
| Molecular Formula | C34H34N2O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | 4-[(E)-3-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-3-phenylpiperidin-1-yl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | C[C@@H](NCC1CCN(C(=O)/C=C/c2ccc(C(=O)O)cc2)CC1c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C34H34N2O3/c1-24(30-13-7-11-26-10-5-6-12-31(26)30)35-22-29-20-21-36(23-32(29)27-8-3-2-4-9-27)33(37)19-16-25-14-17-28(18-15-25)34(38)39/h2-19,24,29,32,35H,20-23H2,1H3,(H,38,39)/b19-16+/t24-,29?,32?/m1/s1 |
| InChIKey | SKQKHRMLHHBZER-BSUQPCBYSA-N |
| XLogP | 6.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|