C28H30N2O3 — CID 59178634
(E)-4-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpiperidin-1-yl]-4-oxobut-2-enoic acid (PubChem CID 59178634) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is (E)-4-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpiperidin-1-yl]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpiperidin-1-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 59178634 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (E)-4-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpiperidin-1-yl]-4-oxobut-2-enoic acid |
| SMILES | C[C@@H](NCC1CN(C(=O)/C=C/C(=O)O)CCC1c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H30N2O3/c1-20(24-13-7-11-22-10-5-6-12-26(22)24)29-18-23-19-30(27(31)14-15-28(32)33)17-16-25(23)21-8-3-2-4-9-21/h2-15,20,23,25,29H,16-19H2,1H3,(H,32,33)/b15-14+/t20-,23?,25?/m1/s1 |
| InChIKey | NVGOOAHASHORNB-LTCHNLCOSA-N |
| XLogP | 4.76 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|