C32H31N3O5 — CID 59178741
4-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpiperidine-1-carbonyl]-2-nitrobenzoic acid (PubChem CID 59178741) has the molecular formula C32H31N3O5 and a molecular weight of 537.62 g/mol. Its IUPAC name is 4-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpiperidine-1-carbonyl]-2-nitrobenzoic acid.
| Compound Name | 4-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpiperidine-1-carbonyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 59178741 |
| Molecular Formula | C32H31N3O5 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 4-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-phenylpiperidine-1-carbonyl]-2-nitrobenzoic acid |
| SMILES | C[C@@H](NCC1CN(C(=O)c2ccc(C(=O)O)c([N+](=O)[O-])c2)CCC1c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C32H31N3O5/c1-21(26-13-7-11-23-10-5-6-12-28(23)26)33-19-25-20-34(17-16-27(25)22-8-3-2-4-9-22)31(36)24-14-15-29(32(37)38)30(18-24)35(39)40/h2-15,18,21,25,27,33H,16-17,19-20H2,1H3,(H,37,38)/t21-,25?,27?/m1/s1 |
| InChIKey | IKOONYSSGGFOHK-KYDWWNIQSA-N |
| XLogP | 6.04 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|