C22H20N4O4 — CID 59180927
ethyl 2-[2-amino-5-[(E)-2-[(5E)-5-[cyano(isocyano)methylidene]-4-isocyano-2,2-dimethylfuran-3-yl]ethenyl]phenoxy]acetate (PubChem CID 59180927) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is ethyl 2-[2-amino-5-[(E)-2-[(5E)-5-[cyano(isocyano)methylidene]-4-isocyano-2,2-dimethylfuran-3-yl]ethenyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-amino-5-[(E)-2-[(5E)-5-[cyano(isocyano)methylidene]-4-isocyano-2,2-dimethylfuran-3-yl]ethenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 59180927 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | ethyl 2-[2-amino-5-[(E)-2-[(5E)-5-[cyano(isocyano)methylidene]-4-isocyano-2,2-dimethylfuran-3-yl]ethenyl]phenoxy]acetate |
| SMILES | [C-]#[N+]C1=C(/C=C/c2ccc(N)c(OCC(=O)OCC)c2)C(C)(C)O/C1=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C22H20N4O4/c1-6-28-19(27)13-29-18-11-14(8-10-16(18)24)7-9-15-20(26-5)21(17(12-23)25-4)30-22(15,2)3/h7-11H,6,13,24H2,1-3H3/b9-7+,21-17+ |
| InChIKey | XZRMPXAJRWSNHS-PFHPZTIBSA-N |
| XLogP | 3.86 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|