C35H41N3O2 — CID 148793658
N,N-dibutyl-4-[(E)-2-[4-[(E)-2-[(5E)-4-isocyano-5-(1-isocyanoethylidene)-2,2-dimethylfuran-3-yl]ethenyl]phenyl]ethenyl]-3-methoxyaniline (PubChem CID 148793658) has the molecular formula C35H41N3O2 and a molecular weight of 535.73 g/mol. Its IUPAC name is N,N-dibutyl-4-[(E)-2-[4-[(E)-2-[(5E)-4-isocyano-5-(1-isocyanoethylidene)-2,2-dimethylfuran-3-yl]ethenyl]phenyl]ethenyl]-3-methoxyaniline.
| Compound Name | N,N-dibutyl-4-[(E)-2-[4-[(E)-2-[(5E)-4-isocyano-5-(1-isocyanoethylidene)-2,2-dimethylfuran-3-yl]ethenyl]phenyl]ethenyl]-3-methoxyaniline |
|---|---|
| PubChem CID | 148793658 |
| Molecular Formula | C35H41N3O2 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | N,N-dibutyl-4-[(E)-2-[4-[(E)-2-[(5E)-4-isocyano-5-(1-isocyanoethylidene)-2,2-dimethylfuran-3-yl]ethenyl]phenyl]ethenyl]-3-methoxyaniline |
| SMILES | [C-]#[N+]C1=C(/C=C/c2ccc(/C=C/c3ccc(N(CCCC)CCCC)cc3OC)cc2)C(C)(C)O/C1=C(\C)[N+]#[C-] |
| InChI | InChI=1S/C35H41N3O2/c1-9-11-23-38(24-12-10-2)30-21-20-29(32(25-30)39-8)19-17-27-13-15-28(16-14-27)18-22-31-33(37-7)34(26(3)36-6)40-35(31,4)5/h13-22,25H,9-12,23-24H2,1-5,8H3/b19-17+,22-18+,34-26+ |
| InChIKey | OMRATMQZKTZARJ-JJPATNIRSA-N |
| XLogP | 9.42 |
| TPSA | 30.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|