C50H42N2Si2 — CID 59182181
9,9,21,21-tetramethyl-6-N,6-N,18-N,18-N-tetraphenyl-9,21-disilahexacyclo[11.11.0.02,10.03,8.014,22.015,20]tetracosa-1(13),2(10),3(8),4,6,11,14(22),15(20),16,18,23-undecaene-6,18-diamine (PubChem CID 59182181) has the molecular formula C50H42N2Si2 and a molecular weight of 727.07 g/mol. Its IUPAC name is 9,9,21,21-tetramethyl-6-N,6-N,18-N,18-N-tetraphenyl-9,21-disilahexacyclo[11.11.0.02,10.03,8.014,22.015,20]tetracosa-1(13),2(10),3(8),4,6,11,14(22),15(20),16,18,23-undecaene-6,18-diamine.
| Compound Name | 9,9,21,21-tetramethyl-6-N,6-N,18-N,18-N-tetraphenyl-9,21-disilahexacyclo[11.11.0.02,10.03,8.014,22.015,20]tetracosa-1(13),2(10),3(8),4,6,11,14(22),15(20),16,18,23-undecaene-6,18-diamine |
|---|---|
| PubChem CID | 59182181 |
| Molecular Formula | C50H42N2Si2 |
| Molecular Weight | 727.07 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | 9,9,21,21-tetramethyl-6-N,6-N,18-N,18-N-tetraphenyl-9,21-disilahexacyclo[11.11.0.02,10.03,8.014,22.015,20]tetracosa-1(13),2(10),3(8),4,6,11,14(22),15(20),16,18,23-undecaene-6,18-diamine |
| SMILES | C[Si]1(C)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2c1ccc1c3c(ccc21)[Si](C)(C)c1cc(N(c2ccccc2)c2ccccc2)ccc1-3 |
| InChI | InChI=1S/C50H42N2Si2/c1-53(2)45-31-29-42-41(49(45)43-27-25-39(33-47(43)53)51(35-17-9-5-10-18-35)36-19-11-6-12-20-36)30-32-46-50(42)44-28-26-40(34-48(44)54(46,3)4)52(37-21-13-7-14-22-37)38-23-15-8-16-24-38/h5-34H,1-4H3 |
| InChIKey | YMWSYJWTLSPUFF-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.07 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|