C42H36Si2 — CID 59182321
CID 59182321 (PubChem CID 59182321) has the molecular formula C42H36Si2 and a molecular weight of 596.92 g/mol.
| Compound Name | CID 59182321 |
|---|---|
| PubChem CID | 59182321 |
| Molecular Formula | C42H36Si2 |
| Molecular Weight | 596.92 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | — |
| SMILES | c1ccc(-c2ccc3c(c2)[Si]2(CCCC2)c2c4c(c5ccccc5c2-3)-c2ccc(-c3ccccc3)cc2[Si]42CCCC2)cc1 |
| InChI | InChI=1S/C42H36Si2/c1-3-13-29(14-4-1)31-19-21-35-37(27-31)43(23-9-10-24-43)41-39(35)33-17-7-8-18-34(33)40-36-22-20-32(30-15-5-2-6-16-30)28-38(36)44(42(40)41)25-11-12-26-44/h1-8,13-22,27-28H,9-12,23-26H2 |
| InChIKey | WGAPSFAGAZDHGE-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.92 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|