C22H23BrN2O3 — CID 59187249
2-[2-[3-bromo-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethyl]isoindole-1,3-dione (PubChem CID 59187249) has the molecular formula C22H23BrN2O3 and a molecular weight of 443.34 g/mol. Its IUPAC name is 2-[2-[3-bromo-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[3-bromo-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59187249 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-[2-[3-bromo-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1ccc(OCCN2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C22H23BrN2O3/c23-19-15-16(7-8-20(19)28-14-13-24-10-3-4-11-24)9-12-25-21(26)17-5-1-2-6-18(17)22(25)27/h1-2,5-8,15H,3-4,9-14H2 |
| InChIKey | KIXHXMJQMMAXAE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|