C22H32Br2N2O2S — CID 143911467
4-bromo-2-methylthiophene;N-[2-[3-bromo-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethyl]formamide;ethane (PubChem CID 143911467) has the molecular formula C22H32Br2N2O2S and a molecular weight of 548.39 g/mol. Its IUPAC name is 4-bromo-2-methylthiophene;N-[2-[3-bromo-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethyl]formamide;ethane.
| Compound Name | 4-bromo-2-methylthiophene;N-[2-[3-bromo-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethyl]formamide;ethane |
|---|---|
| PubChem CID | 143911467 |
| Molecular Formula | C22H32Br2N2O2S |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 4-bromo-2-methylthiophene;N-[2-[3-bromo-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethyl]formamide;ethane |
| SMILES | CC.Cc1cc(Br)cs1.O=CNCCc1ccc(OCCN2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C15H21BrN2O2.C5H5BrS.C2H6/c16-14-11-13(5-6-17-12-19)3-4-15(14)20-10-9-18-7-1-2-8-18;1-4-2-5(6)3-7-4;1-2/h3-4,11-12H,1-2,5-10H2,(H,17,19);2-3H,1H3;1-2H3 |
| InChIKey | YGBXULPZSYSIOL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|