C19H22Br2N2O3S — CID 45272172
4-bromo-N-[2-[3-bromo-4-(2-morpholin-4-ylethoxy)phenyl]ethyl]thiophene-2-carboxamide (PubChem CID 45272172) has the molecular formula C19H22Br2N2O3S and a molecular weight of 518.27 g/mol. Its IUPAC name is 4-bromo-N-[2-[3-bromo-4-(2-morpholin-4-ylethoxy)phenyl]ethyl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-[2-[3-bromo-4-(2-morpholin-4-ylethoxy)phenyl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45272172 |
| Molecular Formula | C19H22Br2N2O3S |
| Molecular Weight | 518.27 g/mol |
| Exact Mass | 515.97 |
| IUPAC Name | 4-bromo-N-[2-[3-bromo-4-(2-morpholin-4-ylethoxy)phenyl]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCc1ccc(OCCN2CCOCC2)c(Br)c1)c1cc(Br)cs1 |
| InChI | InChI=1S/C19H22Br2N2O3S/c20-15-12-18(27-13-15)19(24)22-4-3-14-1-2-17(16(21)11-14)26-10-7-23-5-8-25-9-6-23/h1-2,11-13H,3-10H2,(H,22,24) |
| InChIKey | TUHVKPCMNPVYQI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |