C19H26BrN3O2 — CID 44546761
N-[2-[3-bromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]-1-methylpyrrole-2-carboxamide (PubChem CID 44546761) has the molecular formula C19H26BrN3O2 and a molecular weight of 408.34 g/mol. Its IUPAC name is N-[2-[3-bromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-[3-bromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 44546761 |
| Molecular Formula | C19H26BrN3O2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[2-[3-bromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CN(C)CCCOc1ccc(CCNC(=O)c2cccn2C)cc1Br |
| InChI | InChI=1S/C19H26BrN3O2/c1-22(2)11-5-13-25-18-8-7-15(14-16(18)20)9-10-21-19(24)17-6-4-12-23(17)3/h4,6-8,12,14H,5,9-11,13H2,1-3H3,(H,21,24) |
| InChIKey | QITHZBODGRJJHI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|