C19H20BrN3O2 — CID 69094619
N-[2-[3-bromo-4-(2-pyrrol-1-ylethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 69094619) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is N-[2-[3-bromo-4-(2-pyrrol-1-ylethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[2-[3-bromo-4-(2-pyrrol-1-ylethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 69094619 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-[2-[3-bromo-4-(2-pyrrol-1-ylethoxy)phenyl]ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCc1ccc(OCCn2cccc2)c(Br)c1)c1ccc[nH]1 |
| InChI | InChI=1S/C19H20BrN3O2/c20-16-14-15(7-9-22-19(24)17-4-3-8-21-17)5-6-18(16)25-13-12-23-10-1-2-11-23/h1-6,8,10-11,14,21H,7,9,12-13H2,(H,22,24) |
| InChIKey | XZXLJBBJSDKBGP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |