C17H19Br2NO4S — CID 59187250
4-bromo-N-[2-[3-bromo-4-(2,2-dimethoxyethoxy)phenyl]ethyl]thiophene-2-carboxamide (PubChem CID 59187250) has the molecular formula C17H19Br2NO4S and a molecular weight of 493.22 g/mol. Its IUPAC name is 4-bromo-N-[2-[3-bromo-4-(2,2-dimethoxyethoxy)phenyl]ethyl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-[2-[3-bromo-4-(2,2-dimethoxyethoxy)phenyl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59187250 |
| Molecular Formula | C17H19Br2NO4S |
| Molecular Weight | 493.22 g/mol |
| Exact Mass | 490.94 |
| IUPAC Name | 4-bromo-N-[2-[3-bromo-4-(2,2-dimethoxyethoxy)phenyl]ethyl]thiophene-2-carboxamide |
| SMILES | COC(COc1ccc(CCNC(=O)c2cc(Br)cs2)cc1Br)OC |
| InChI | InChI=1S/C17H19Br2NO4S/c1-22-16(23-2)9-24-14-4-3-11(7-13(14)19)5-6-20-17(21)15-8-12(18)10-25-15/h3-4,7-8,10,16H,5-6,9H2,1-2H3,(H,20,21) |
| InChIKey | QLUYBXXIDXPYIR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|